powered by
View 2D structures from SMILES strings vector
viewstr(smis = NULL, width = 500, height = 500, nrow = 2, ncol = 2, legend = "")
is a SMILES strings vector to submit.
of the picture
is the number of rows for the table of molecular depictions
is the number of columns for the table of molecular depictions
is the text to appear for each molecular depiction in the top left corner
a plot of requested 2D structures.
# NOT RUN { viewstr(c("c1ccc2ccc3c(NCCN(C)C)cc(nc3c2c1)", "c1ccc2ccc3c(NCCN(CC)CCCl)cc(nc3c2c1)", "c1ccc2ccc3c(NC(CC)CC)cc(nc3c2c1)", "c1ccc2ccc3c(c2c1)ncc(c3NCCNCC=CCCCC)")) # }
Run the code above in your browser using DataLab